TY - JOUR
T1 - Synthesis and Structures of (p-Halogenophenoxy)phosphazenes
T2 - Comparison of the Structures of Cyclic and Linear Short-Chain Species
AU - Allcock, Harry R.
AU - Ngo, Dennis C.
AU - Parvez, Masood
AU - Visscher, Karyn B.
PY - 1994/5/1
Y1 - 1994/5/1
N2 - The crystal structures of OP(OR)2NP(OR)3, where OR = O-C6H4F-p, O-C6H4Cl-p, and O-C6H4Br-p, and [NP- (OR)2]3, where OR = O-C6H4F-p, O-C6H4Cl-p, O-C6H4Br-p and O-C6H4I-p, were determined by X-ray crystallography. These small molecule phosphazenes are structural models for the corresponding high polymers, and their structures provide insight into the conformation and nature of bonding in the polymeric species. Crystals of OP(O-C6H4F-p)2NP(O-C6H4F-p)3 are triclinic with cell dimensions of a = 8.394(2) Å, b = 10.690(3) Å, c = 16.760(4) Å, a = 86.99(2)°, β = 84.82(2)°, γ = 69.66(2)°, space group P[formula omitted], Z = 2. Crystals of OP(0-C6H4-Cl-p)2NP(O-C6H4Cl-p)3 are triclinic with cell dimension of a = 10.513(6) Å, b = 12.574(3) Å, c = 13.359(5) Å, α = 91.83(3)°, β = 106.76(4)°, γ = 104.68(3)°, space group. and Z = 2. Crystals of OP(O-C6H4Br-p)2NP-(O-C6H4Br-p) are triclinic with cell dimension of a = 9.839(2) Å, b = 12.373(4) Å, c = 14.286(3) Å, α = 103.74(2)°, β = 91.76(2)°, γ = 100.89(2)°, space group P[formula omitted], and Z = 2. Crystals of the cyclic species are monoclinic. The unit cell dimensions are as follows: [NP(O-C6H4F-p)2] 3, a = 20.860(5) Å, b = 8.085(12) Å, c = 21.813(5) Å, β = 104.62(3)°, space group P21/n, Z = 4; [NP(O-C6H4Cl-p)2]3, a = 17.746(9) Å, b = 7.623(7) Å, c = 27.856(10) Å, β= 91.76(12)°, space group P21/c,Z = 4; [NP(O-C6H4Br-p)2]3, a = 13.680(5) Å, b = 31.316(7) Å, c = 9.289(3).β = 90.70(3)°, space group P21/n, Z = 4; [NP(O-C6H4I-p)2]3, a = 13.700(6) Å, b = 9.381(11) Å, c = 32.675(16) Å, β = 95.72(4)°, space group P21/c, Z = 4. The results show that the P-N bond lengths in both the short-chain and cyclic species are very similar, with an average value of 1.55 Å. Evidence for side group stacking can be detected in the crystal lattice of both the cyclic and linear oligomers, and these arrangements are analogous to those expected in polymer microcrystallites.
AB - The crystal structures of OP(OR)2NP(OR)3, where OR = O-C6H4F-p, O-C6H4Cl-p, and O-C6H4Br-p, and [NP- (OR)2]3, where OR = O-C6H4F-p, O-C6H4Cl-p, O-C6H4Br-p and O-C6H4I-p, were determined by X-ray crystallography. These small molecule phosphazenes are structural models for the corresponding high polymers, and their structures provide insight into the conformation and nature of bonding in the polymeric species. Crystals of OP(O-C6H4F-p)2NP(O-C6H4F-p)3 are triclinic with cell dimensions of a = 8.394(2) Å, b = 10.690(3) Å, c = 16.760(4) Å, a = 86.99(2)°, β = 84.82(2)°, γ = 69.66(2)°, space group P[formula omitted], Z = 2. Crystals of OP(0-C6H4-Cl-p)2NP(O-C6H4Cl-p)3 are triclinic with cell dimension of a = 10.513(6) Å, b = 12.574(3) Å, c = 13.359(5) Å, α = 91.83(3)°, β = 106.76(4)°, γ = 104.68(3)°, space group. and Z = 2. Crystals of OP(O-C6H4Br-p)2NP-(O-C6H4Br-p) are triclinic with cell dimension of a = 9.839(2) Å, b = 12.373(4) Å, c = 14.286(3) Å, α = 103.74(2)°, β = 91.76(2)°, γ = 100.89(2)°, space group P[formula omitted], and Z = 2. Crystals of the cyclic species are monoclinic. The unit cell dimensions are as follows: [NP(O-C6H4F-p)2] 3, a = 20.860(5) Å, b = 8.085(12) Å, c = 21.813(5) Å, β = 104.62(3)°, space group P21/n, Z = 4; [NP(O-C6H4Cl-p)2]3, a = 17.746(9) Å, b = 7.623(7) Å, c = 27.856(10) Å, β= 91.76(12)°, space group P21/c,Z = 4; [NP(O-C6H4Br-p)2]3, a = 13.680(5) Å, b = 31.316(7) Å, c = 9.289(3).β = 90.70(3)°, space group P21/n, Z = 4; [NP(O-C6H4I-p)2]3, a = 13.700(6) Å, b = 9.381(11) Å, c = 32.675(16) Å, β = 95.72(4)°, space group P21/c, Z = 4. The results show that the P-N bond lengths in both the short-chain and cyclic species are very similar, with an average value of 1.55 Å. Evidence for side group stacking can be detected in the crystal lattice of both the cyclic and linear oligomers, and these arrangements are analogous to those expected in polymer microcrystallites.
UR - http://www.scopus.com/inward/record.url?scp=33751157228&partnerID=8YFLogxK
UR - http://www.scopus.com/inward/citedby.url?scp=33751157228&partnerID=8YFLogxK
U2 - 10.1021/ic00088a008
DO - 10.1021/ic00088a008
M3 - Article
AN - SCOPUS:33751157228
SN - 0020-1669
VL - 33
SP - 2090
EP - 2102
JO - Inorganic chemistry
JF - Inorganic chemistry
IS - 10
ER -